![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| (18) D01-PartC3 PAP ..> | 2017-07-25 15:39 | 247K | |
| (19) D01-PartC3 PAP ..> | 2017-07-25 15:39 | 130K | |
| 01 DOC.pdf | 2017-05-05 08:58 | 39K | |
| 02 DOC.pdf | 2017-05-05 08:58 | 38K | |
| 03 DOC.pdf | 2017-05-05 08:58 | 113K | |
| 04 DOC.pdf | 2017-05-05 08:58 | 34K | |
| 05 DOC.pdf | 2017-05-05 08:58 | 45K | |
| 080356 25-02-2019.PDF | 2019-02-25 09:24 | 1.4M | |
| 090533.PDF | 2019-06-11 10:55 | 970K | |
| 0948401225.PDF | 2018-08-21 11:07 | 2.0M | |
| 1. Cover Page.docx | 2019-09-30 16:35 | 486K | |
| 1. Cover Page.pdf | 2019-10-01 14:18 | 129K | |
| 2. CONTENTS-Section ..> | 2017-07-25 15:39 | 13K | |
| 3 THE TENDER (Autosa..> | 2017-07-25 15:39 | 636K | |
| 3x HARD DRIVES FOR H..> | 2023-08-16 11:13 | 71K | |
| 3x hardrives for HP ..> | 2023-08-16 10:27 | 7.0K | |
| 4. PART T2-Returnabl..> | 2017-07-25 15:39 | 825K | |
| 4th Qtr SDBIP Report..> | 2018-10-08 14:54 | 2.4M | |
| 5. PART C1- Section ..> | 2017-07-25 15:39 | 562K | |
| 7. Part C3-Scope of ..> | 2017-07-25 15:39 | 1.4M | |
| 8. PART C4-site info..> | 2017-07-25 15:39 | 164K | |
| 9. PART C5-White pag..> | 2017-07-25 15:39 | 593K | |
| 20a meter box.pdf | 2017-10-04 10:04 | 355K | |
| 22 seater-0814201808..> | 2018-08-14 09:50 | 49K | |
| 100L evergreen trees..> | 2017-08-03 09:41 | 46K | |
| 221.pdf | 2018-07-26 09:21 | 1.2M | |
| 121112.PDF | 2018-08-27 14:58 | 3.1M | |
| 144347.PDF | 2018-11-01 07:14 | 1.5M | |
| 144459.PDF | 2018-11-01 07:14 | 2.3M | |
| 144607.PDF | 2018-11-01 07:14 | 1.4M | |
| 10382112201.PDF | 2018-09-05 11:10 | 2.1M | |
| 545895654545444.pdf | 2018-07-26 09:21 | 581K | |
| 20181005114131124.pdf | 2018-10-08 14:51 | 4.3M | |
| 20181005114319642.pdf | 2018-10-08 14:48 | 2.7M | |
| A1-06212019113118.pdf | 2019-06-21 12:42 | 96K | |
| A2-06212019113139.pdf | 2019-06-21 12:42 | 88K | |
| A4BLANK-080720180932..> | 2018-08-07 12:28 | 36K | |
| A4 BLANK PAGES.PDF | 2019-03-28 17:04 | 1.2M | |
| A4 BLANK PAGES .pdf | 2020-08-20 14:12 | 2.4M | |
| A4 Blank pages.pdf | 2019-07-16 20:11 | 772K | |
| A4 newsletter-082720..> | 2020-08-27 21:14 | 48K | |
| AARTO11367.PDF | 2018-10-29 14:44 | 1.8M | |
| ACCOMODATION.pdf | 2017-08-23 08:08 | 55K | |
| ACCOMODATION FOR 120..> | 2018-11-08 09:07 | 60K | |
| AD2114065 -13x5p2.pdf | 2021-04-07 09:42 | 347K | |
| ADVERT-0626202411424..> | 2024-06-26 14:12 | 89K | |
| ADVERT-ALLDAYS ROAD ..> | 2023-09-29 15:21 | 846K | |
| ADVERT-ALLDAYS ROAD ..> | 2023-09-29 15:21 | 901K | |
| ADVERT-AVON ROAD MAI..> | 2023-09-29 15:21 | 867K | |
| ADVERT-DILAENENG ROA..> | 2021-09-29 07:50 | 54K | |
| ADVERT-HIRING OF PLA..> | 2020-09-09 14:59 | 3.5M | |
| ADVERT-MILLINEUM PAR..> | 2023-09-29 15:21 | 810K | |
| ADVERT-PURASPAN ROAD..> | 2023-09-29 15:21 | 944K | |
| ADVERT-Plant Hire.pdf | 2020-09-09 15:06 | 3.4M | |
| ADVERT-RECONSTRUCTIO..> | 2021-02-05 13:06 | 935K | |
| ADVERT-SUPPLY AND DE..> | 2021-12-07 11:01 | 49K | |
| ADVERT-TAAIBOSCH ROA..> | 2023-09-29 15:21 | 901K | |
| ADVERT- WINGWALLS CO..> | 2020-12-15 10:08 | 232K | |
| ADVERT FOR WITTEN IN..> | 2020-12-02 18:32 | 1.1M | |
| ADVERT FOR WITTEN IN..> | 2020-11-25 09:35 | 1.1M | |
| ADVERT MARQUEE TENT..> | 2018-05-24 11:51 | 226K | |
| ADVERT SUPPLY AND DE..> | 2021-01-22 09:49 | 210K | |
| ADVERT SUPPLY AND DE..> | 2021-03-23 09:33 | 160K | |
| AFS-01032019124238.pdf | 2019-03-01 12:36 | 71K | |
| AFS AND INDIGENT TEN..> | 2026-03-19 10:26 | 775K | |
| AMENDED Tender docum..> | 2022-11-01 15:21 | 1.0M | |
| ANTI VIRUS-082120181..> | 2018-08-22 08:46 | 38K | |
| AVON ROAD AND STORMW..> | 2020-11-03 12:51 | 444K | |
| Accomodation (polokw..> | 2019-01-14 13:32 | 651K | |
| Accomodation for 100..> | 2017-08-10 14:14 | 738K | |
| Accomodation for war..> | 2016-09-07 07:36 | 110K | |
| Adert General landfi..> | 2022-07-07 11:50 | 70K | |
| Advert 3 tenders.pdf | 2016-09-06 16:27 | 187K | |
| Advert Calenders and..> | 2024-09-06 13:18 | 759K | |
| Advert SLR CAMERAS24..> | 2024-09-06 13:18 | 759K | |
| Advert airconsoctobe..> | 2016-09-06 16:26 | 238K | |
| Advert bank.pdf | 2016-09-06 16:47 | 197K | |
| Advert embroedary ma..> | 2018-11-20 18:07 | 703K | |
| Advert for senwanarw..> | 2022-07-04 13:35 | 71K | |
| Advertisement - Pane..> | 2016-09-07 07:31 | 121K | |
| Advertising Services..> | 2017-11-24 10:51 | 374K | |
| Advert landscaping11..> | 2016-09-06 16:25 | 243K | |
| Advert publicity and..> | 2024-09-06 13:18 | 747K | |
| Airdeck cable2019082..> | 2019-08-27 09:35 | 609K | |
| Avon Multipurpose Ce..> | 2024-10-04 10:29 | 8.3M | |
| BACK UP-082120181625..> | 2018-08-22 08:46 | 43K | |
| BASSIC COMPUTER TRAI..> | 2017-12-11 11:58 | 68K | |
| BID NOTICE AND INVIT..> | 2016-09-22 16:09 | 87K | |
| BIDS INVITATIONS2112..> | 2023-12-21 09:25 | 74K | |
| BLOUBERG_241118_1616..> | 2024-11-19 11:16 | 524K | |
| BM03-25-26 - Renovat..> | 2025-08-08 10:55 | 25M | |
| BM03-25-26 - Renovat..> | 2025-08-08 13:12 | 25M | |
| BM03-25-26 - Renovat..> | 2025-08-08 10:55 | 25M | |
| BM11-24-25 Tender do..> | 2025-01-29 14:18 | 716K | |
| BM29-22-23 ERRATUM T..> | 2023-06-21 12:27 | 99K | |
| BM30-22-23 ERRATUM T..> | 2023-06-21 12:30 | 110K | |
| BM31-22-23 ERRATUM T..> | 2023-06-21 12:32 | 97K | |
| BOOTS INVITATION-070..> | 2018-09-08 10:31 | 43K | |
| BOQ RATES.pdf | 2019-10-04 10:43 | 44K | |
| BOQ SUMMARY.pdf | 2019-10-04 10:43 | 13K | |
| Banners for ward com..> | 2016-09-07 07:36 | 108K | |
| Basic computer train..> | 2017-11-30 12:00 | 42K | |
| Bids Tenders-2110201..> | 2017-02-07 14:58 | 69K | |
| Bill of Quantities -..> | 2024-10-04 10:29 | 2.3M | |
| Blouberg Municipal T..> | 2025-08-01 08:42 | 420K | |
| Branding of municipa..> | 2017-11-30 12:00 | 40K | |
| CALENDERS-0509201814..> | 2018-09-05 15:51 | 45K | |
| CANCELLATION OF TEND..> | 2023-09-13 08:17 | 292K | |
| CAPS FOR 19TH WARD C..> | 2022-09-02 13:45 | 63K | |
| CARTRIDGES-112320201..> | 2020-11-23 12:53 | 608K | |
| CARTRIDGES.PDF | 2019-03-28 17:04 | 1.9M | |
| CARTRIDGES08122019.pdf | 2019-08-12 12:25 | 710K | |
| CATRIDTES-0807201809..> | 2018-08-07 12:28 | 56K | |
| CLEANING MATERIAL-15..> | 2019-04-15 09:24 | 66K | |
| CONFERENCE PACKAGE.PDF | 2018-10-08 14:44 | 1.4M | |
| CONSTRUCTION OF AVON..> | 2024-09-28 11:50 | 646K | |
| COVER PROPOSALS.doc ..> | 2017-08-30 14:15 | 236K | |
| COVER PROPOSALS Unif..> | 2018-09-03 09:48 | 85K | |
| COVID 19 -PPE .pdf | 2020-08-20 14:16 | 2.0M | |
| CRECHES BoQl-2017-18..> | 2017-07-25 15:39 | 103K | |
| Calendar-10022019154..> | 2019-10-02 16:26 | 56K | |
| CamScanner 07-08-202..> | 2024-07-08 11:25 | 381K | |
| Camping Material.pdf | 2017-08-10 14:14 | 669K | |
| Cartridges-111320231..> | 2023-11-14 08:46 | 83K | |
| Cartridges2017.pdf | 2017-11-30 12:00 | 39K | |
| Catridge20172.pdf | 2017-12-01 11:17 | 40K | |
| Chasis for Tipper Tr..> | 2016-09-06 16:31 | 260K | |
| Cleaning MATERIAL-11..> | 2020-11-23 12:53 | 935K | |
| Cleaning Material.pdf | 2017-07-25 09:51 | 91K | |
| Cleaning materials s..> | 2016-09-06 16:27 | 123K | |
| Coopers hall.PDF | 2019-04-01 08:57 | 1.9M | |
| Cover Page New.pdf | 2019-10-04 10:43 | 1.9M | |
| Covid ppe-0820202009..> | 2020-08-20 12:14 | 3.2M | |
| Crusher sand.pdf | 2019-08-20 16:21 | 649K | |
| Cubic Ready Mix.pdf | 2019-08-20 16:21 | 624K | |
| Curtain.pdf | 2019-08-20 16:21 | 712K | |
| DESIGN AND PRINT-091..> | 2018-09-17 19:34 | 55K | |
| DIARIES-082120181623..> | 2018-08-22 08:46 | 44K | |
| DIESEL-0807201809315..> | 2018-08-07 12:28 | 36K | |
| DIESELlll.pdf | 2019-01-29 15:59 | 527K | |
| DOC.pdf | 2017-04-07 09:21 | 52K | |
| DOC000.pdf | 2017-04-07 09:21 | 51K | |
| DOC000sdfdfds.pdf | 2017-08-01 10:15 | 100K | |
| DOC000sfsd.pdf | 2017-05-30 14:11 | 56K | |
| DOC00013061703.pdf | 2017-06-13 11:54 | 35K | |
| DOC000130716.pdf | 2017-06-13 10:04 | 61K | |
| DOC001.pdf | 2017-04-07 09:21 | 53K | |
| DOC001sdfd.pdf | 2017-05-30 14:11 | 55K | |
| DOC001130617.pdf | 2017-06-13 10:04 | 39K | |
| DOC002.pdf | 2017-04-07 09:20 | 52K | |
| DOC002dgf.pdf | 2017-05-30 14:11 | 42K | |
| DOC003dgf.pdf | 2017-05-30 14:11 | 39K | |
| DOC031116-0311201616..> | 2016-11-03 16:13 | 66K | |
| DOC031116-0311201616..> | 2016-11-03 16:14 | 63K | |
| DOC031116-0311201616..> | 2016-11-03 16:14 | 62K | |
| DOC031116-0311201616..> | 2016-11-03 16:16 | 94K | |
| DOC031116-0311201616..> | 2016-11-03 16:16 | 50K | |
| DOC031116-0311201616..> | 2016-11-03 16:17 | 51K | |
| DOC031116-0311201616..> | 2016-11-03 16:17 | 65K | |
| DOC11mash-1127202011..> | 2020-11-27 14:30 | 1.3M | |
| DOC101.pdf | 2017-12-01 10:59 | 40K | |
| DOC2018.pdf | 2018-02-07 11:35 | 59K | |
| DOC130617.pdf | 2017-06-13 10:04 | 129K | |
| DOC291116.pdf | 2016-11-29 08:12 | 57K | |
| DOC13061702.pdf | 2017-06-13 11:54 | 67K | |
| DOCsgg.pdf | 2017-05-30 14:11 | 74K | |
| DRAFT ADVERT -Bloube..> | 2019-11-21 08:00 | 143K | |
| DRAFT ADVERT -Bloube..> | 2019-08-15 11:01 | 121K | |
| DRP sever GEN 9 HP.pdf | 2017-08-16 14:57 | 42K | |
| Diaries-082720201524..> | 2020-08-27 21:15 | 49K | |
| Diesel-0817202015385..> | 2020-08-20 12:14 | 4.4M | |
| Diesel.PDF | 2018-10-08 14:44 | 1.4M | |
| Diesel.pdf | 2020-08-20 14:21 | 2.3M | |
| Diesel 50ppm-0418202..> | 2024-04-19 15:34 | 73K | |
| Diesel August.pdf | 2019-08-20 16:22 | 631K | |
| Dilaeneng road and s..> | 2020-11-03 12:51 | 366K | |
| Display flags portra..> | 2020-08-20 12:15 | 6.2M | |
| Doc1.pdf | 2020-01-10 15:56 | 331K | |
| Draft_Tender_Documen..> | 2019-09-30 16:35 | 745K | |
| Draft_Tender_Documen..> | 2019-10-01 14:18 | 2.7M | |
| Drawing1.pdf | 2019-11-26 14:52 | 361K | |
| Drawing2.pdf | 2019-11-26 14:52 | 1.1M | |
| Drawing3.pdf | 2019-11-26 14:52 | 321K | |
| Drawing4.pdf | 2019-11-26 14:52 | 83K | |
| Drawing5.pdf | 2019-11-26 14:52 | 77K | |
| Drawing6.pdf | 2019-11-26 14:52 | 102K | |
| Drawing7.pdf | 2019-11-26 14:52 | 49K | |
| Drawing8.pdf | 2019-11-26 14:52 | 36K | |
| Drawings.pdf | 2017-07-25 15:40 | 702K | |
| Drum ABC Bundle Invi..> | 2017-10-04 10:04 | 360K | |
| ELECTRICAL.PDF | 2018-10-09 12:08 | 1.3M | |
| ELECTRICAL.pdf | 2017-10-12 11:14 | 45K | |
| ELECTRICAL MATERIAL-..> | 2020-09-22 11:46 | 51K | |
| EMBROIDERY-111420181..> | 2018-11-14 16:27 | 51K | |
| EMULSION drums-09162..> | 2020-09-16 15:01 | 1.1M | |
| EPW PERSONAL PROTECT..> | 2020-11-23 12:52 | 67K | |
| EPWP PROTECTIVE-0907..> | 2018-09-08 10:33 | 44K | |
| EPWP Personal Protec..> | 2025-08-08 11:34 | 494K | |
| EPWP Protective clot..> | 2020-08-20 14:21 | 3.5M | |
| EPWP Work Suits.pdf | 2016-09-06 16:30 | 251K | |
| ERATUM-1704201809510..> | 2018-04-17 10:54 | 18K | |
| ERRATUM-112220190832..> | 2019-11-22 09:04 | 31K | |
| ERRATUM-110620201257..> | 2020-11-06 13:05 | 30K | |
| ERRATUM-HIRING OF PL..> | 2020-09-22 12:04 | 20K | |
| ERRATUM-HIRING OF PL..> | 2020-09-22 12:08 | 26K | |
| ERRATUM FOR PROVISIO..> | 2022-10-06 14:07 | 459K | |
| ERRUTUM FOR SEFIHLAM..> | 2023-07-14 10:15 | 97K | |
| EXTENSION OF CLOSING..> | 2022-11-04 11:11 | 459K | |
| EXTENSION OF CLOSING..> | 2023-01-03 11:08 | 460K | |
| Electrical28102018.PDF | 2018-10-29 14:44 | 2.2M | |
| Electrical Airdeck I..> | 2017-10-04 10:04 | 364K | |
| Electrical material ..> | 2016-09-06 16:31 | 112K | |
| Electrical poles-092..> | 2020-09-22 11:45 | 41K | |
| Electrical tools [la..> | 2020-09-22 11:44 | 41K | |
| Emulsion Drums Invit..> | 2017-10-04 10:04 | 1.7M | |
| Erratum-Bids under R..> | 2018-05-24 10:18 | 237K | |
| Erratum-Electrical ..> | 2019-10-04 07:25 | 251K | |
| Erratum-Electrical ..> | 2019-10-01 10:54 | 235K | |
| Erratum-Electricity ..> | 2018-06-21 21:23 | 414K | |
| Erratum-Energy Effic..> | 2018-07-16 08:43 | 207K | |
| Erratum-Energy Effic..> | 2018-07-26 10:27 | 209K | |
| Erratum-Landfill sit..> | 2019-06-19 09:21 | 208K | |
| Erratum-Provision fo..> | 2019-06-28 10:43 | 251K | |
| Erratum-Towerfontein..> | 2019-11-21 08:00 | 116K | |
| Erratum-Town planner..> | 2018-06-18 18:07 | 399K | |
| Erratum2-Electricity..> | 2018-07-16 08:43 | 222K | |
| Erratum Electrical p..> | 2019-10-08 16:21 | 34K | |
| Erratum Supplimentar..> | 2021-03-05 08:32 | 514K | |
| Erratum Supply of Di..> | 2018-04-04 09:56 | 255K | |
| Erratum advert for P..> | 2021-03-02 12:03 | 264K | |
| Erratum advert for S..> | 2024-01-04 09:08 | 556K | |
| Erratum for panel of..> | 2025-03-11 11:22 | 479K | |
| Erratum on Caps20190..> | 2019-08-07 12:03 | 101K | |
| Erratum on Roll0503..> | 2021-03-05 10:24 | 286K | |
| Erratum on Supply an..> | 2021-03-02 12:04 | 120K | |
| Erratum on Valuation..> | 2021-03-05 10:24 | 286K | |
| Erratum operation an..> | 2025-08-25 10:08 | 353K | |
| Erratum to Tender Do..> | 2022-11-01 15:22 | 530K | |
| Erratum to Tender Do..> | 2022-11-01 15:15 | 530K | |
| Erratun on Leasing o..> | 2021-02-23 14:53 | 82K | |
| Extension of Clising..> | 2017-08-04 09:42 | 203K | |
| Extension of closing..> | 2023-11-01 16:43 | 293K | |
| FADILITATION-0821201..> | 2018-08-21 15:38 | 56K | |
| FINAL ADVERT15042021..> | 2021-04-15 14:09 | 60K | |
| FINAL DRAFT OF THE T..> | 2019-10-01 14:18 | 3.9M | |
| FLags and Portrait p..> | 2020-08-20 14:22 | 4.4M | |
| Facilitation.PDF | 2019-06-04 10:53 | 2.7M | |
| Fencing.PDF | 2018-11-26 10:55 | 1.7M | |
| Final ERRATUM_Tender..> | 2016-09-06 16:23 | 243K | |
| Final_Tender_Advert_..> | 2016-09-06 16:23 | 241K | |
| Fire Extinguishers.pdf | 2016-09-06 16:28 | 117K | |
| Fire Extinguishers o..> | 2016-09-06 16:30 | 118K | |
| GRADER WEBSITE-08022..> | 2019-02-08 11:16 | 48K | |
| GRMUM2425015_MUM_Mun..> | 2021-04-21 10:32 | 479K | |
| Gen9 HP Server.pdf | 2019-11-18 14:52 | 856K | |
| Grader plates2018102..> | 2018-10-29 12:39 | 1.6M | |
| Guard House Invitati..> | 2017-10-04 10:04 | 357K | |
| HIGH MAST MATERIAL 2..> | 2020-09-22 11:46 | 40K | |
| HP 48 port switches,..> | 2017-07-25 09:44 | 67K | |
| Heavy Duty Refuse Ba..> | 2016-09-06 16:37 | 292K | |
| High Mast Material-0..> | 2020-09-22 11:45 | 47K | |
| Hiring of Video and ..> | 2016-09-06 16:33 | 199K | |
| IDP.pdf | 2017-10-12 11:14 | 65K | |
| IDPBUDGET BOOKLETS-0..> | 2024-07-10 10:15 | 78K | |
| IDP booklet.PDF | 2018-10-08 14:39 | 1.4M | |
| IMG-20230517-WA0002.jpg | 2023-05-17 14:41 | 64K | |
| IMG-20230517-WA0003.jpg | 2023-05-17 14:32 | 48K | |
| IMG-20230517-WA0004.jpg | 2023-05-17 14:41 | 64K | |
| IMG-20231220-WA0001.jpg | 2023-12-20 14:47 | 16K | |
| INSTALLATION-0509201..> | 2018-09-05 15:51 | 42K | |
| INSTALLATION OF CULV..> | 2020-12-10 13:24 | 53K | |
| INSURANCE SUMMARY OF..> | 2021-04-21 10:32 | 68K | |
| INVERAAN CRECHE.zip | 2017-07-26 09:29 | 5.0M | |
| INVITATION.pdf | 2019-09-20 09:35 | 1.3M | |
| INVITATION 1-0128202..> | 2020-01-29 08:06 | 126K | |
| INVITATION 2-0128202..> | 2020-01-29 08:06 | 144K | |
| INVITATION 3-0128202..> | 2020-01-29 08:06 | 122K | |
| INVITATION 4-0128202..> | 2020-01-29 08:06 | 135K | |
| INVITATION FOR BID F..> | 2022-02-10 11:09 | 72K | |
| INVITATION FOR BID O..> | 2022-01-12 15:28 | 48K | |
| INVITATION FOR SUPPL..> | 2022-01-12 15:28 | 47K | |
| INVITATION FOR SUPPL..> | 2022-01-12 15:28 | 45K | |
| INVITATION FOR SUPPL..> | 2022-01-12 15:28 | 63K | |
| INVITATION FOR SUPPL..> | 2022-01-12 15:28 | 58K | |
| INVITATION FOR SUPPL..> | 2022-01-12 15:28 | 54K | |
| INVITATION supply an..> | 2022-01-19 09:31 | 56K | |
| Indermark internal s..> | 2017-08-02 13:12 | 8.8M | |
| Infared Thermometer ..> | 2020-08-20 12:15 | 3.3M | |
| Invitation - Alldays..> | 2018-03-19 12:39 | 368K | |
| Invitation - Alldays..> | 2018-03-19 17:53 | 372K | |
| Invitation Newslette..> | 2016-09-06 16:44 | 145K | |
| Invitation SENWABARW..> | 2020-02-14 12:19 | 68K | |
| Invitation Scow back..> | 2016-09-06 16:45 | 145K | |
| Invitation Trees.pdf | 2016-09-06 16:45 | 182K | |
| Invitation for Heavy..> | 2016-09-06 16:40 | 202K | |
| Invitation for Prote..> | 2016-09-06 16:41 | 185K | |
| Invitation for Stati..> | 2016-09-06 16:42 | 144K | |
| Invitation for Unifo..> | 2016-09-06 16:42 | 203K | |
| Invitation for Waste..> | 2016-09-06 16:43 | 144K | |
| Invitation for Worki..> | 2016-09-06 16:43 | 97K | |
| Invitation for fix b..> | 2016-09-06 16:39 | 154K | |
| Invitation for fixin..> | 2016-09-06 16:39 | 196K | |
| Invitation for plasm..> | 2016-09-06 16:40 | 145K | |
| Invitation for promo..> | 2016-09-06 16:41 | 145K | |
| Invitation fror Equi..> | 2016-09-06 16:44 | 146K | |
| Invitation to Submit..> | 2022-10-13 08:50 | 724K | |
| Invitation to Submit..> | 2022-10-13 08:49 | 306K | |
| Invitation to Submit..> | 2022-10-13 08:50 | 362K | |
| Invitation to Submit..> | 2022-10-13 08:50 | 364K | |
| Invitation to Submit..> | 2022-10-13 08:50 | 304K | |
| Invitation to Submit..> | 2022-10-13 08:50 | 299K | |
| Invitation to Submit..> | 2022-10-13 09:36 | 307K | |
| Invitation to Submit..> | 2022-10-13 08:50 | 521K | |
| Invitation to bid (E..> | 2016-09-07 07:39 | 80K | |
| Invitation to bid.pdf | 2018-03-08 10:22 | 49K | |
| Invitation two lapto..> | 2021-03-15 14:09 | 157K | |
| Invititation for age..> | 2019-06-26 12:39 | 1.3M | |
| Irregation dripping ..> | 2017-07-25 09:50 | 72K | |
| LAPTOPS-082120181621..> | 2018-08-22 08:46 | 58K | |
| LICECES-100220191546..> | 2019-10-02 16:26 | 57K | |
| LUBRICANTS FOR GRADE..> | 2019-08-28 15:47 | 603K | |
| Lapto22p.pdf | 2017-08-10 14:14 | 660K | |
| Laptop-1002201915471..> | 2019-10-02 16:26 | 53K | |
| Laptops.pdf | 2020-07-20 15:53 | 1.4M | |
| Lekgwara access road..> | 2026-02-05 12:31 | 515K | |
| Lekgwara advert02-11..> | 2026-02-11 10:20 | 506K | |
| Locality Map.pdf | 2019-11-26 14:52 | 14M | |
| MAMEHLABE ROAD AND S..> | 2020-11-03 12:51 | 366K | |
| MAYOR TO LAUNCH ROAD..> | 2020-11-03 10:11 | 13K | |
| MBD%201.docm%20accom..> | 2017-08-30 08:15 | 143K | |
| MBD%202..pdf | 2017-08-30 08:15 | 8.0K | |
| MBD-7.1-CONTRACT-FOR..> | 2019-10-04 10:43 | 71K | |
| MBD-7.2-CONTRACT-FOR..> | 2019-10-04 10:43 | 72K | |
| MBD.pdf | 2017-08-30 08:15 | 8.0K | |
| MBD 1..pdf | 2018-06-18 18:09 | 160K | |
| MBD 1. accomodation ..> | 2018-07-26 12:55 | 155K | |
| MBD 1.docm COPIERS 1..> | 2017-08-30 14:15 | 143K | |
| MBD 1.pdf | 2017-07-26 09:51 | 160K | |
| MBD 1 Protective Clo..> | 2018-09-03 09:48 | 161K | |
| MBD 2..pdf | 2017-08-30 14:15 | 8.0K | |
| MBD 2.pdf | 2017-07-26 09:51 | 125K | |
| MBD 3.1.pdf | 2016-12-09 12:47 | 115K | |
| MBD 3.2.pdf | 2016-12-09 12:48 | 195K | |
| MBD 4 DECLARATION OF..> | 2017-08-30 14:15 | 166K | |
| MBD 6.1.pdf | 2016-12-09 12:49 | 271K | |
| MBD 6.1 in terms of ..> | 2017-08-30 14:15 | 59K | |
| MBD 6.1 in terms of ..> | 2017-07-26 09:51 | 276K | |
| MBD 6.2 Local Conten..> | 2018-09-03 09:48 | 195K | |
| MBD 8.doc | 2017-08-30 14:15 | 43K | |
| MBD 8.pdf | 2017-07-26 09:51 | 151K | |
| MBD 9.doc | 2017-08-30 14:15 | 51K | |
| MBD 9.pdf | 2016-12-09 12:51 | 308K | |
| MBDdocmaccomodationd..> | 2017-08-30 08:15 | 143K | |
| MICROSOFT 365-100920..> | 2024-10-09 16:06 | 76K | |
| MMAMEHLABE CRECHE.zip | 2017-07-26 09:30 | 4.9M | |
| MOGmusic - ELOHIM.mp3 | 2019-11-20 09:12 | 10M | |
| MOKHURUMELA CRECHE.zip | 2017-07-26 09:50 | 4.9M | |
| MOTOR GRADER-2908201..> | 2018-09-03 10:13 | 60K | |
| MS OFF 2016.PDF | 2018-10-16 08:36 | 1.4M | |
| MS OFFICE 10PR.PDF | 2018-10-16 08:36 | 1.4M | |
| MUNICIPAL EPWP CASUA..> | 2018-08-15 12:14 | 51K | |
| Maintenance Material..> | 2017-08-16 14:57 | 57K | |
| Maintenance Material..> | 2017-08-16 14:57 | 65K | |
| Maintenance Matrial ..> | 2017-08-14 12:40 | 57K | |
| Mayor Shadrack Malul..> | 2023-12-20 13:14 | 192K | |
| Medical-100220191548..> | 2019-10-02 16:26 | 53K | |
| Meter Box E3.pdf | 2016-09-06 16:46 | 106K | |
| NETWORIIHG-082120181..> | 2018-08-22 08:46 | 42K | |
| NETWORK SWITCH.pdf | 2019-11-08 11:41 | 796K | |
| Network Requirement.pdf | 2016-09-07 07:33 | 117K | |
| Network Requirements..> | 2016-09-06 16:28 | 125K | |
| New Doc 2018-07-24.pdf | 2018-07-26 09:14 | 851K | |
| New Doc 2018-08-18.pdf | 2018-08-23 10:12 | 804K | |
| New Doc 2020-02-12 1..> | 2020-02-12 12:27 | 1.1M | |
| New Doc 2022-05-12 1..> | 2022-05-13 08:03 | 446K | |
| New Doc_1.pdf | 2018-04-17 09:05 | 568K | |
| Newsletter.pdf | 2016-09-06 16:33 | 199K | |
| NumberPlate.pdf | 2017-10-12 15:22 | 42K | |
| Numbering of graves.pdf | 2017-11-30 12:00 | 45K | |
| Office Equipments-08..> | 2024-08-12 11:42 | 69K | |
| Overhauling of engin..> | 2016-09-06 16:34 | 262K | |
| PANEL OF CONSULTANT ..> | 2022-02-02 12:43 | 37K | |
| PMU DraftTenderAdver..> | 2016-09-06 16:46 | 233K | |
| PMU Draft_Tender_Adv..> | 2016-09-06 16:38 | 202K | |
| PURASPAN CRECHE.zip | 2017-07-26 09:27 | 4.8M | |
| Palm Trees.pdf | 2016-09-06 16:34 | 249K | |
| Parts for TLB.pdf | 2016-09-06 16:32 | 208K | |
| Phase 6 document.pdf | 2021-04-22 09:37 | 13M | |
| Prepaid meters-15102..> | 2018-10-16 08:36 | 44K | |
| Prolaser 04 14-01-20..> | 2019-01-14 13:32 | 598K | |
| Promotional Material..> | 2017-08-03 09:41 | 317K | |
| Promotional material..> | 2019-11-18 14:52 | 1.2M | |
| Promotional material..> | 2019-08-01 16:11 | 604K | |
| Promotional material..> | 2016-09-06 16:35 | 124K | |
| Promotional material..> | 2016-09-07 07:35 | 124K | |
| Protective clothing.pdf | 2017-08-03 09:41 | 54K | |
| Protective clothing ..> | 2020-08-20 14:24 | 3.4M | |
| Protective clothings..> | 2017-08-03 09:41 | 57K | |
| Purchase of cables a..> | 2017-11-30 12:00 | 64K | |
| Purchase of cables a..> | 2017-11-30 12:00 | 65K | |
| Purchase of transfor..> | 2017-11-30 12:00 | 44K | |
| REBRAHDING-082120181..> | 2018-09-03 10:27 | 59K | |
| REBRANDING-290820181..> | 2018-09-03 10:13 | 49K | |
| REGRAVELING OF DANTZ..> | 2024-09-03 14:00 | 678K | |
| REPAIR-0821201814431..> | 2018-09-03 10:27 | 59K | |
| RFP010817.pdf | 2017-08-21 15:32 | 351K | |
| RFP010817hh.pdf | 2017-08-01 13:33 | 248K | |
| RFQ-11232020121335 2..> | 2020-11-23 12:46 | 56K | |
| RFQ Cleaning Materia..> | 2024-09-13 14:03 | 1.4M | |
| RFQTECH102324-091320..> | 2024-09-13 14:03 | 931K | |
| RFQ for Calculation ..> | 2023-07-03 15:51 | 122K | |
| ROAD.PDF | 2018-10-09 12:08 | 1.3M | |
| Raweshi Networking.pdf | 2016-09-07 07:33 | 125K | |
| Re-Advert Tender Adv..> | 2023-10-19 09:34 | 271K | |
| Rebranding.pdf | 2018-11-26 11:59 | 569K | |
| Refuse.PDF | 2018-10-08 15:15 | 2.4M | |
| Remote Access.pdf | 2020-07-20 15:53 | 1.4M | |
| Renovations of Traff..> | 2017-07-25 09:50 | 72K | |
| Request for Quotatio..> | 2018-01-11 15:15 | 75K | |
| Revised Tender doc f..> | 2020-09-22 16:52 | 1.2M | |
| Revised Tender doc f..> | 2020-09-22 16:50 | 1.2M | |
| SCAN0003.PDF | 2020-09-02 09:06 | 958K | |
| SCAN0003081116.PDF | 2016-11-08 15:47 | 1.4M | |
| SCAN0004.PDF | 2020-09-02 15:18 | 1.0M | |
| SCAN000402sep.PDF | 2020-09-01 18:34 | 229K | |
| SCAN000420200903.PDF | 2020-09-03 07:35 | 1.0M | |
| SD AIRDECK-010820200..> | 2020-01-08 12:51 | 48K | |
| SD CONCRETE MIXER-01..> | 2020-01-08 12:51 | 50K | |
| SD DIAMOND PLATES-01..> | 2020-01-08 12:51 | 101K | |
| SD ROAD MARKING-0108..> | 2020-01-08 12:51 | 50K | |
| SD TON RIDE-01082020..> | 2020-01-08 12:51 | 50K | |
| SECOND ERRUTUM FOR S..> | 2023-07-19 10:27 | 455K | |
| SERVER-1022202412123..> | 2024-10-22 14:28 | 78K | |
| SITE PEGGIN-09172018..> | 2018-09-17 19:34 | 53K | |
| SKM_36718032811420.pdf | 2018-03-28 13:29 | 611K | |
| SKM_36718032812550.pdf | 2018-03-28 14:42 | 632K | |
| SLR CAMERA2019828.pdf | 2019-08-28 10:59 | 632K | |
| SOCCER, NETBALL AND ..> | 2017-12-13 09:19 | 74K | |
| SPEC QUALITY REVIEW2..> | 2020-07-27 10:01 | 196K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:28 | 392K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:28 | 286K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:28 | 304K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:28 | 289K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:29 | 296K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:29 | 327K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:29 | 282K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:29 | 309K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:29 | 293K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:29 | 307K | |
| SSITA-POL-M170919143..> | 2017-09-19 14:30 | 301K | |
| STATIONERY20190812.pdf | 2019-08-12 12:25 | 707K | |
| STRATEGIC PLANNING-2..> | 2018-09-03 10:13 | 67K | |
| SUMMARY OF ASSETS RE..> | 2021-04-21 10:32 | 222K | |
| SUPPLY AND DELIVERY ..> | 2023-12-20 12:33 | 79K | |
| SUPPLY AND DELIVERY ..> | 2017-12-11 11:58 | 76K | |
| SUPPLY AND INSTALLAT..> | 2017-12-11 11:58 | 59K | |
| Sanitary Removal ten..> | 2020-02-06 11:55 | 890K | |
| Scan_0073010218.pdf | 2018-02-01 09:49 | 715K | |
| Scan_0074010218.pdf | 2018-02-01 09:49 | 475K | |
| Scan_0075010218.pdf | 2018-02-01 09:49 | 451K | |
| Scan_0093.pdf | 2018-03-28 10:12 | 646K | |
| Scan f001.pdf | 2018-11-14 17:13 | 1.0M | |
| Scow back Containers..> | 2016-09-06 16:35 | 196K | |
| Security tender re-a..> | 2026-03-31 19:17 | 374K | |
| Senwabarwana Electri..> | 2019-10-04 13:56 | 2.6M | |
| Servicing of fire ex..> | 2017-07-25 09:47 | 71K | |
| Servicing of fire ex..> | 2017-07-25 09:48 | 69K | |
| Size 5 socer ball ki..> | 2017-07-25 09:45 | 68K | |
| Soccer , Netball and..> | 2017-11-21 09:47 | 71K | |
| Soccer, netball and ..> | 2017-11-21 15:02 | 71K | |
| Soccer, netball and ..> | 2017-11-21 15:02 | 69K | |
| Soccer, netball and ..> | 2017-11-21 15:02 | 68K | |
| Sound system.pdf | 2019-07-30 15:32 | 1.0M | |
| Sound system and Vid..> | 2016-09-07 07:34 | 108K | |
| Specification Form b..> | 2016-09-07 07:34 | 120K | |
| Stationary -General ..> | 2020-08-20 14:25 | 4.6M | |
| Stationary General-0..> | 2020-08-20 12:15 | 7.9M | |
| Stationery.pdf | 2017-07-25 09:45 | 88K | |
| Stationery 04.pdf | 2017-07-25 09:46 | 92K | |
| Stationery 05.pdf | 2017-07-25 09:46 | 88K | |
| Stationery 220725.pdf | 2025-07-22 09:10 | 510K | |
| Stationery cartridge..> | 2020-08-20 14:26 | 4.5M | |
| Suggestin Boxes.pdf | 2017-08-14 12:40 | 42K | |
| Supply and delivery ..> | 2017-07-25 09:49 | 62K | |
| Supply for Survey Eq..> | 2024-08-29 08:57 | 343K | |
| Surgical Gear .pdf | 2020-08-20 14:29 | 2.1M | |
| Surgical gear -ppe.pdf | 2020-08-20 14:28 | 3.7M | |
| Surgical gear 2-0820..> | 2020-08-20 12:16 | 4.9M | |
| Switches.pdf | 2020-07-20 15:53 | 1.4M | |
| TENDER ADVERT-DESIGN..> | 2024-02-07 13:52 | 723K | |
| TENDER ADVERT-SEFIHL..> | 2023-07-03 15:48 | 63K | |
| TENDER ADVERT FOR PP..> | 2024-11-13 14:27 | 923K | |
| TENDER ADVERTS.pdf | 2023-05-26 16:31 | 1.6M | |
| TENDER ADVERT SECURI..> | 2022-12-06 07:37 | 85K | |
| TENDER INVITATION - ..> | 2022-10-12 12:30 | 97K | |
| TENDER INVITATION - ..> | 2022-10-10 14:48 | 83K | |
| TENDER NOTICE - 06 O..> | 2022-10-10 13:01 | 957K | |
| TENDER NOTICE AND IN..> | 2022-05-10 15:19 | 97K | |
| TENDER NOTICE AND IN..> | 2022-05-10 15:18 | 79K | |
| TENDER NOTICE AND IN..> | 2025-09-12 10:51 | 256K | |
| TENDER NOTICE AND IN..> | 2022-09-19 13:40 | 1.0M | |
| TENDER NOTICE AND IN..> | 2022-09-19 13:39 | 752K | |
| TENDER NOTICE AND RE..> | 2021-12-17 07:47 | 60K | |
| TENDER REGISTER AS A..> | 2024-08-23 14:15 | 85K | |
| TOR Electical engin..> | 2018-04-23 12:40 | 97K | |
| TOR leasing of 10 ma..> | 2017-08-30 14:15 | 285K | |
| TRAFFIC.pdf | 2017-10-12 11:14 | 55K | |
| TRAFFIC000.pdf | 2017-10-12 11:14 | 13K | |
| TRAFIC STATION CALL ..> | 2016-09-06 16:00 | 96K | |
| TRAVELLING AGECY-111..> | 2018-11-14 16:27 | 62K | |
| TREES-09172018091647..> | 2018-09-17 19:34 | 35K | |
| Tende advert Panel o..> | 2018-06-06 11:28 | 453K | |
| Tender-Unbundling15.pdf | 2016-09-06 16:48 | 88K | |
| Tender-Unbundling16.pdf | 2016-09-06 16:22 | 265K | |
| Tender.pdf | 2018-03-01 10:57 | 41K | |
| Tender10042018.pdf | 2018-04-10 10:08 | 162K | |
| Tender Advert-Bosehl..> | 2021-09-30 10:09 | 187K | |
| Tender Advert - Elet..> | 2023-10-19 09:35 | 281K | |
| Tender Advert- Stree..> | 2020-12-04 09:13 | 866K | |
| Tender Advert - town..> | 2023-10-19 09:35 | 271K | |
| Tender Advert Attorn..> | 2021-02-15 10:08 | 246K | |
| Tender Advert GIS sy..> | 2021-06-07 07:56 | 203K | |
| Tender Advert Hiring..> | 2021-09-20 16:26 | 183K | |
| Tender Advert Instal..> | 2021-10-06 08:08 | 184K | |
| Tender Advert Regrav..> | 2021-09-29 15:40 | 193K | |
| Tender Advert Rehabi..> | 2020-01-30 14:44 | 330K | |
| Tender Advert Revenu..> | 2020-08-19 14:45 | 309K | |
| Tender Advert Traffi..> | 2021-09-15 08:11 | 193K | |
| Tender Advertisement..> | 2024-07-08 09:47 | 778K | |
| Tender Advert securi..> | 2019-11-18 07:52 | 230K | |
| Tender Adverts for A..> | 2020-10-09 11:03 | 622K | |
| Tender Document - Cl..> | 2019-10-01 14:17 | 7.4M | |
| Tender Document.pdf | 2019-09-30 16:37 | 1.9M | |
| Tender Document Cons..> | 2017-07-26 09:51 | 1.6M | |
| Tender Document Witt..> | 2020-09-03 17:37 | 4.1M | |
| Tender Document for ..> | 2019-11-27 07:51 | 892K | |
| Tender Document for ..> | 2019-11-26 11:14 | 892K | |
| Tender Document for ..> | 2019-11-27 07:51 | 892K | |
| Tender Document for ..> | 2018-11-23 13:40 | 1.1M | |
| Tender Document for ..> | 2018-11-20 15:50 | 1.1M | |
| Tender Drawings - Av..> | 2024-10-04 10:29 | 16M | |
| Tender Erratum.pdf | 2019-05-07 14:45 | 168K | |
| Tender ReAdvert secu..> | 2016-09-06 16:20 | 268K | |
| Tender_Advert_EEDSM ..> | 2018-07-19 12:41 | 209K | |
| Tender_Advert__Compl..> | 2017-10-24 09:00 | 188K | |
| Tender_Advert__Const..> | 2018-09-26 13:26 | 129K | |
| Tender_Advert__Const..> | 2018-10-01 11:27 | 136K | |
| Tender_Advert__Const..> | 2017-09-22 09:25 | 189K | |
| Tender_Advert__Elect..> | 2019-09-27 15:33 | 138K | |
| Tender_Advert__Elect..> | 2017-11-15 14:21 | 150K | |
| Tender advert -Airco..> | 2019-01-24 22:50 | 248K | |
| Tender advert -Unbun..> | 2019-05-24 18:42 | 273K | |
| Tender advert electr..> | 2025-09-26 15:28 | 472K | |
| Tender advert for In..> | 2025-05-15 10:44 | 576K | |
| Tender advert for Ko..> | 2025-06-18 08:05 | 447K | |
| Tender advert for S..> | 2021-05-20 08:07 | 155K | |
| Tender advert for U..> | 2021-06-02 12:53 | 148K | |
| Tender advert for ci..> | 2025-08-05 11:20 | 286K | |
| Tender advert for pa..> | 2025-09-12 08:12 | 244K | |
| Tender advert for pr..> | 2024-10-08 11:02 | 1.4M | |
| Tender advert for pr..> | 2025-09-25 09:01 | 481K | |
| Tender advert for un..> | 2024-11-19 14:22 | 1.3M | |
| Tender advert survey..> | 2025-01-29 15:55 | 451K | |
| Tender advert travel..> | 2018-11-20 16:14 | 728K | |
| Tender doc for Compi..> | 2020-06-04 15:50 | 970K | |
| Tender doc for Leasi..> | 2021-02-15 10:09 | 1.0M | |
| Tender doc for Suppl..> | 2021-02-22 12:01 | 940K | |
| Tender doc for Suppl..> | 2021-02-22 12:04 | 721K | |
| Tender doc for Unbun..> | 2020-06-12 08:33 | 972K | |
| Tender doc for VAT r..> | 2020-02-07 12:27 | 876K | |
| Tender doc for panel..> | 2020-02-06 11:55 | 898K | |
| Tender doc protectiv..> | 2019-09-27 07:32 | 860K | |
| Tender document for ..> | 2019-06-20 11:12 | 1.1M | |
| Tender document for ..> | 2019-06-04 16:10 | 1.0M | |
| Tender document for ..> | 2024-09-13 14:07 | 809K | |
| Tender document for ..> | 2024-10-09 09:16 | 702K | |
| Tender document for ..> | 2024-09-13 14:07 | 728K | |
| Tender document for ..> | 2025-01-29 14:18 | 1.1M | |
| Tender documents for..> | 2017-07-27 13:46 | 8.4M | |
| Tender notice and in..> | 2025-09-19 07:55 | 604K | |
| Tender register2425 ..> | 2024-08-21 15:32 | 84K | |
| Tenders.pdf | 2017-11-23 14:58 | 130K | |
| Tender to website co..> | 2016-09-07 07:38 | 44K | |
| Tendet advert panels..> | 2026-01-19 16:26 | 796K | |
| Terms%20Accommodatio..> | 2017-08-30 08:15 | 137K | |
| Terms Accommodation ..> | 2017-09-04 11:28 | 274K | |
| Terms of Reference E..> | 2017-07-21 09:52 | 1.2M | |
| Terms of Reference E..> | 2017-07-21 09:52 | 1.2M | |
| Terms of Reference ..> | 2018-04-23 12:38 | 104K | |
| Thermometer.pdf | 2020-08-20 14:29 | 2.0M | |
| Tnder Document for A..> | 2017-07-27 13:47 | 16M | |
| Towerfontein Creche ..> | 2019-11-26 14:52 | 7.5M | |
| Tractor Tyre.pdf | 2017-08-14 12:40 | 43K | |
| Trolly bags.pdf | 2018-07-26 09:21 | 415K | |
| Trophies for schools..> | 2016-09-06 16:29 | 123K | |
| UPS.pdf | 2020-07-20 15:53 | 1.4M | |
| VM WARE-082120181625..> | 2018-08-22 08:46 | 39K | |
| VMware.pdf | 2020-07-20 15:53 | 1.4M | |
| Waste Bins.pdf | 2016-09-06 16:36 | 196K | |
| Waste Industrial Bin..> | 2016-09-07 07:37 | 65K | |
| Z20 Forms.pdf | 2016-09-06 16:36 | 196K | |
| accomodation-0530201..> | 2018-05-30 09:45 | 49K | |
| advert-0311201909233..> | 2019-03-11 09:24 | 62K | |
| advert.pdf | 2016-12-14 15:14 | 1.9M | |
| advert alldays inter..> | 2022-10-06 14:07 | 36K | |
| advert engineers.pdf | 2022-02-02 09:55 | 664K | |
| advert for database..> | 2016-09-06 16:25 | 119K | |
| back to school campa..> | 2019-11-28 14:10 | 1.6M | |
| books-04102019122333..> | 2019-04-10 16:16 | 124K | |
| borehole0001.pdf | 2019-10-30 19:58 | 1.1M | |
| cabinets.pdf | 2019-02-21 16:03 | 480K | |
| calender.pdf | 2017-08-08 12:04 | 62K | |
| carbot net-110520181..> | 2018-05-11 15:20 | 52K | |
| catridges-0817202015..> | 2020-08-20 12:14 | 7.7M | |
| cctv-15102018111621.pdf | 2018-10-16 08:36 | 55K | |
| chicken.pdf | 2017-10-31 10:17 | 50K | |
| cleaning materials-0..> | 2018-08-14 09:50 | 63K | |
| cold mix bags-091620..> | 2020-09-16 15:02 | 1.2M | |
| delivery of equipmen..> | 2020-02-13 11:45 | 82K | |
| diaries.pdf | 2017-08-08 12:04 | 65K | |
| drawing gate house-0..> | 2020-02-06 07:57 | 780K | |
| elctricalmaterial-04..> | 2019-04-10 16:16 | 121K | |
| eratum-1804201908394..> | 2019-04-18 08:41 | 44K | |
| erratum Retention po..> | 2025-02-24 09:54 | 149K | |
| erratum for Appointm..> | 2024-11-28 09:23 | 261K | |
| erratum for BM26-24-..> | 2025-05-27 15:13 | 258K | |
| erratum for procurem..> | 2024-10-11 09:18 | 141K | |
| erratum for unbundli..> | 2024-11-20 09:40 | 299K | |
| errutum,Accommodatio..> | 2017-10-11 12:34 | 22K | |
| extension of Clising..> | 2017-08-03 16:00 | 140K | |
| facilitation.pdf | 2018-12-07 08:51 | 1.2M | |
| fencing.pdf | 2017-10-31 10:17 | 47K | |
| fire exten.pdf | 2019-12-11 09:59 | 883K | |
| grader.pdf | 2017-10-31 10:17 | 44K | |
| hydrolic ffoil130920..> | 2018-09-13 15:41 | 1.0M | |
| img-113161734.pdf | 2017-01-16 08:05 | 56K | |
| img-124102737.pdf | 2018-01-24 10:34 | 45K | |
| img-213102432.pdf | 2017-02-13 11:04 | 35K | |
| img-170912124239.pdf | 2017-09-12 14:18 | 788K | |
| img-171010091207.pdf | 2017-10-10 09:41 | 367K | |
| img-171103101805.pdf | 2017-11-03 10:31 | 204K | |
| img-171103103759.pdf | 2017-11-03 10:48 | 392K | |
| img-171103103830.pdf | 2017-11-03 10:49 | 427K | |
| img-171103103859.pdf | 2017-11-03 10:50 | 435K | |
| img-171103103923.pdf | 2017-11-03 10:50 | 392K | |
| img-180511090818.pdf | 2018-05-11 09:26 | 369K | |
| img-180511090839.pdf | 2018-05-11 09:26 | 380K | |
| img-180511090853.pdf | 2018-05-11 09:26 | 381K | |
| img-180511090929.pdf | 2018-05-11 09:27 | 749K | |
| img-191126121947-000..> | 2019-11-26 14:29 | 249K | |
| img-200226124402.pdf | 2020-03-17 12:48 | 705K | |
| img-X18101817.pdf | 2017-10-18 10:57 | 238K | |
| img-X18101844.pdf | 2017-10-18 10:57 | 237K | |
| img-X18101916.pdf | 2017-10-18 10:57 | 756K | |
| img-X18101948.pdf | 2017-10-18 10:57 | 398K | |
| img-Z14145331.pdf | 2016-12-14 15:14 | 51K | |
| invitation1-11052018..> | 2018-05-11 14:53 | 47K | |
| invitation1-11052018..> | 2018-05-11 14:50 | 42K | |
| invitationdeisel1.pdf | 2017-10-19 13:14 | 66K | |
| invitation for bid p..> | 2022-02-08 07:53 | 183K | |
| invitation to Fix Gr..> | 2019-12-05 08:07 | 205K | |
| invitation to Fix Gr..> | 2019-12-05 08:07 | 207K | |
| invitation to tender..> | 2020-09-02 14:02 | 62K | |
| invitation to tender..> | 2021-11-29 16:14 | 828K | |
| invitation to tender..> | 2024-09-13 14:07 | 1.0M | |
| laptops.pdf | 2017-08-08 12:04 | 62K | |
| maiatenance Material..> | 2017-08-14 12:40 | 61K | |
| materials.pdf | 2019-10-30 19:58 | 1.3M | |
| nametags.pdf | 2017-08-08 12:04 | 70K | |
| name tags20190828.pdf | 2019-08-28 10:59 | 639K | |
| networking.pdf | 2017-08-08 12:04 | 57K | |
| office equipment0828..> | 2019-08-28 10:59 | 632K | |
| office furniture-082..> | 2020-08-27 21:17 | 62K | |
| promotional Material..> | 2017-08-03 09:41 | 56K | |
| protectectiv clothin..> | 2019-07-25 12:38 | 770K | |
| protective clothing ..> | 2019-07-25 12:38 | 731K | |
| replacement of dilap..> | 2017-10-04 10:04 | 369K | |
| scan..1.pdf | 2017-10-27 08:34 | 92K | |
| scan..2.pdf | 2017-10-27 08:34 | 91K | |
| scan..3.pdf | 2017-10-27 08:34 | 95K | |
| scan..4.pdf | 2017-10-27 08:34 | 92K | |
| scan..5.pdf | 2017-10-27 08:34 | 91K | |
| scan.pdf | 2018-11-22 09:37 | 1.1M | |
| scan0001.pdf | 2016-09-07 07:32 | 267K | |
| scan0023.pdf | 2016-09-07 07:32 | 277K | |
| scan0049.pdf | 2016-09-06 16:48 | 917K | |
| scan0100.pdf | 2018-11-22 09:37 | 1.2M | |
| scan08-03-2019.pdf | 2019-03-08 15:15 | 368K | |
| scan281116.pdf | 2016-11-28 15:43 | 307K | |
| scan2312121.pdf | 2018-12-13 04:04 | 1.1M | |
| scanDiaries.pdf | 2019-11-28 10:40 | 802K | |
| secured red tape2019..> | 2019-07-25 12:38 | 527K | |
| senwabarwana .pdf | 2019-11-06 08:06 | 1.2M | |
| smokedetector.pdf | 2017-08-08 12:04 | 64K | |
| specification for El..> | 2018-09-28 13:36 | 193K | |
| splirMETER.pdf | 2017-10-12 15:22 | 36K | |
| splitmeters-14022019..> | 2019-02-18 14:31 | 53K | |
| stationary-112320201..> | 2020-11-23 12:53 | 65K | |
| stationary A4 Pages-..> | 2020-08-20 12:15 | 4.5M | |
| stationery-081420180..> | 2018-08-14 09:50 | 63K | |
| supply ,Intallation ..> | 2020-10-14 15:13 | 41K | |
| supply and delivery ..> | 2020-11-03 12:51 | 901K | |
| supply and delivery ..> | 2020-09-22 07:48 | 48K | |
| supply and delivery ..> | 2020-11-03 12:51 | 934K | |
| supply and delivery ..> | 2019-11-28 14:10 | 1.6M | |
| supply and delivey o..> | 2020-08-20 14:27 | 1.9M | |
| supply and installat..> | 2017-11-22 10:59 | 139K | |
| supply of 100KVA STA..> | 2021-08-17 14:19 | 42K | |
| surgical gowns-08202..> | 2020-08-20 12:16 | 3.3M | |
| tender-0718201812413..> | 2018-07-19 11:32 | 45K | |
| tender-0805201816244..> | 2018-05-09 07:57 | 73K | |
| tender-2007201811483..> | 2018-07-20 16:15 | 52K | |
| tenderNotice1.pdf | 2017-07-18 09:57 | 70K | |
| tender advert avon a..> | 2025-02-14 11:08 | 498K | |
| tender advert for In..> | 2021-02-19 10:36 | 297K | |
| tender advert for po..> | 2021-02-18 11:00 | 154K | |
| tender adv unbundlin..> | 2024-11-19 08:45 | 88K | |
| tender doc for panel..> | 2020-02-06 11:55 | 882K | |
| tender doc for panel..> | 2020-02-10 11:56 | 891K | |
| tender doc for panel..> | 2020-02-04 15:31 | 892K | |
| tender doc for panel..> | 2020-02-04 15:31 | 892K | |
| tender doc for panel..> | 2020-02-07 12:20 | 881K | |
| tender doc for panel..> | 2020-02-07 12:20 | 895K | |
| tender doc for panel..> | 2020-02-10 11:56 | 894K | |
| tender doc for panel..> | 2020-02-10 11:56 | 891K | |
| tender doc for panel..> | 2020-02-07 12:20 | 881K | |
| tender doc for panel..> | 2020-02-04 15:31 | 891K | |
| tender document for ..> | 2019-09-26 16:20 | 1.1M | |
| tender document for ..> | 2018-11-21 14:49 | 1.1M | |
| tender document for ..> | 2019-01-25 10:18 | 1.1M | |
| tender document for ..> | 2019-01-26 20:33 | 1.1M | |
| tender document for ..> | 2018-11-20 18:07 | 1.0M | |
| tenderdocumentsff.pdf | 2017-07-18 12:31 | 140K | |
| tenders.pdf | 2018-05-09 07:57 | 41K | |
| terms of reference f..> | 2018-09-03 09:48 | 183K | |
| three phase.pdf | 2019-12-05 14:07 | 916K | |
| tnd1.pdf | 2017-07-20 14:38 | 127K | |
| tnd2.pdf | 2017-07-20 14:38 | 99K | |
| tracksuit-1708201815..> | 2018-08-21 17:03 | 44K | |
| traffic uniform (1).pdf | 2018-11-15 16:41 | 110K | |
| training.pdf | 2019-10-30 19:58 | 1.1M | |
| trees 20190725.pdf | 2019-07-25 12:38 | 535K | |
| uniform.pdf | 2018-12-07 08:51 | 1.7M | |
| vidio camera & sound..> | 2017-08-03 09:41 | 48K | |
| vmware.pdf | 2017-08-08 12:04 | 62K | |
| vmware1.pdf | 2019-08-16 16:05 | 834K | |
| wing walls construct..> | 2020-09-03 11:05 | 552K | |
| workshop.pdf | 2019-02-21 16:03 | 730K | |